About 2-chloro-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]acetamide
2-chloro-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]acetamide (PubChem CID 721139) has the molecular formula C11H10ClN3O3S2
and a molecular weight of 331.81 g/mol. Its IUPAC name is 2-chloro-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]acetamide.
Molecular Properties
| Compound Name | 2-chloro-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]acetamide |
| PubChem CID | 721139 |
| Molecular Formula | C11H10ClN3O3S2 |
| Molecular Weight | 331.81 g/mol |
| Exact Mass | 330.99 |
| IUPAC Name | 2-chloro-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]acetamide |
| SMILES | O=C(CCl)Nc1ccc(S(=O)(=O)Nc2nccs2)cc1 |
| InChI | InChI=1S/C11H10ClN3O3S2/c12-7-10(16)14-8-1-3-9(4-2-8)20(17,18)15-11-13-5-6-19-11/h1-6H,7H2,(H,13,15)(H,14,16) |
| InChIKey | NSUHLTKMBRDPDN-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.81 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]acetamide?
The IUPAC name of 2-chloro-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]acetamide (CID 721139) is 2-chloro-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]acetamide.
What is the SMILES notation for 2-chloro-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]acetamide?
The canonical SMILES for 2-chloro-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]acetamide is O=C(CCl)Nc1ccc(S(=O)(=O)Nc2nccs2)cc1.
What is the InChIKey of 2-chloro-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]acetamide?
The InChIKey is NSUHLTKMBRDPDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10ClN3O3S2/c12-7-10(16)14-8-1-3-9(4-2-8)20(17,18)15-11-13-5-6-19-11/h1-6H,7H2,(H,13,15)(H,14,16).
What are the key properties of 2-chloro-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]acetamide?
2-chloro-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]acetamide has a molecular weight of 331.81 g/mol, XLogP of 2.12, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]acetamide is sourced from PubChem (CID 721139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).