C19H22N5OS+ — CID 7211606
N-(1-adamantyl)-3,6-diamino-5-cyanothieno[2,3-b]pyridin-7-ium-2-carboxamide (PubChem CID 7211606) has the molecular formula C19H22N5OS+ and a molecular weight of 368.49 g/mol. Its IUPAC name is N-(1-adamantyl)-3,6-diamino-5-cyanothieno[2,3-b]pyridin-7-ium-2-carboxamide.
| Compound Name | N-(1-adamantyl)-3,6-diamino-5-cyanothieno[2,3-b]pyridin-7-ium-2-carboxamide |
|---|---|
| PubChem CID | 7211606 |
| Molecular Formula | C19H22N5OS+ |
| Molecular Weight | 368.49 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | N-(1-adamantyl)-3,6-diamino-5-cyanothieno[2,3-b]pyridin-7-ium-2-carboxamide |
| SMILES | N#Cc1cc2c(N)c(C(=O)NC34CC5CC(CC(C5)C3)C4)sc2[nH+]c1N |
| InChI | InChI=1S/C19H21N5OS/c20-8-12-4-13-14(21)15(26-18(13)23-16(12)22)17(25)24-19-5-9-1-10(6-19)3-11(2-9)7-19/h4,9-11H,1-3,5-7,21H2,(H2,22,23)(H,24,25)/p+1 |
| InChIKey | TUSPXXHTUISRLJ-UHFFFAOYSA-O |
| XLogP | 2.45 |
| TPSA | 119.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.49 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |