About (3S)-N,N-dimethyl-1,1-dioxothiolan-3-amine
(3S)-N,N-dimethyl-1,1-dioxothiolan-3-amine (PubChem CID 7211727) has the molecular formula C6H13NO2S
and a molecular weight of 163.24 g/mol. Its IUPAC name is (3S)-N,N-dimethyl-1,1-dioxothiolan-3-amine.
Molecular Properties
| Compound Name | (3S)-N,N-dimethyl-1,1-dioxothiolan-3-amine |
| PubChem CID | 7211727 |
| Molecular Formula | C6H13NO2S |
| Molecular Weight | 163.24 g/mol |
| Exact Mass | 163.07 |
| IUPAC Name | (3S)-N,N-dimethyl-1,1-dioxothiolan-3-amine |
| SMILES | CN(C)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C6H13NO2S/c1-7(2)6-3-4-10(8,9)5-6/h6H,3-5H2,1-2H3/t6-/m0/s1 |
| InChIKey | HHOQXOUQXSMWDD-LURJTMIESA-N |
| XLogP | -0.20 |
| TPSA | 45.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | 202 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.24 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S)-N,N-dimethyl-1,1-dioxothiolan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-N,N-dimethyl-1,1-dioxothiolan-3-amine?
The IUPAC name of (3S)-N,N-dimethyl-1,1-dioxothiolan-3-amine (CID 7211727) is (3S)-N,N-dimethyl-1,1-dioxothiolan-3-amine.
What is the SMILES notation for (3S)-N,N-dimethyl-1,1-dioxothiolan-3-amine?
The canonical SMILES for (3S)-N,N-dimethyl-1,1-dioxothiolan-3-amine is CN(C)[C@H]1CCS(=O)(=O)C1.
What is the InChIKey of (3S)-N,N-dimethyl-1,1-dioxothiolan-3-amine?
The InChIKey is HHOQXOUQXSMWDD-LURJTMIESA-N. The full InChI is InChI=1S/C6H13NO2S/c1-7(2)6-3-4-10(8,9)5-6/h6H,3-5H2,1-2H3/t6-/m0/s1.
What are the key properties of (3S)-N,N-dimethyl-1,1-dioxothiolan-3-amine?
(3S)-N,N-dimethyl-1,1-dioxothiolan-3-amine has a molecular weight of 163.24 g/mol, XLogP of -0.20, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-N,N-dimethyl-1,1-dioxothiolan-3-amine is sourced from PubChem (CID 7211727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).