C20H32N3OS+ — CID 7211983
6-[(4-methoxyphenyl)methylsulfanyl]-3-[(1R,5R)-3,3,5-trimethylcyclohexyl]-1,2,3,4-tetrahydro-1,3,5-triazin-3-ium (PubChem CID 7211983) has the molecular formula C20H32N3OS+ and a molecular weight of 362.56 g/mol. Its IUPAC name is 6-[(4-methoxyphenyl)methylsulfanyl]-3-[(1R,5R)-3,3,5-trimethylcyclohexyl]-1,2,3,4-tetrahydro-1,3,5-triazin-3-ium.
| Compound Name | 6-[(4-methoxyphenyl)methylsulfanyl]-3-[(1R,5R)-3,3,5-trimethylcyclohexyl]-1,2,3,4-tetrahydro-1,3,5-triazin-3-ium |
|---|---|
| PubChem CID | 7211983 |
| Molecular Formula | C20H32N3OS+ |
| Molecular Weight | 362.56 g/mol |
| Exact Mass | 362.23 |
| IUPAC Name | 6-[(4-methoxyphenyl)methylsulfanyl]-3-[(1R,5R)-3,3,5-trimethylcyclohexyl]-1,2,3,4-tetrahydro-1,3,5-triazin-3-ium |
| SMILES | COc1ccc(CSC2=NC[NH+]([C@@H]3C[C@H](C)CC(C)(C)C3)CN2)cc1 |
| InChI | InChI=1S/C20H31N3OS/c1-15-9-17(11-20(2,3)10-15)23-13-21-19(22-14-23)25-12-16-5-7-18(24-4)8-6-16/h5-8,15,17H,9-14H2,1-4H3,(H,21,22)/p+1/t15-,17+/m0/s1 |
| InChIKey | HIFPBIJDJXXNPN-DOTOQJQBSA-O |
| XLogP | 2.90 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.56 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |