C17H17N5O2 — CID 7212190
(3aR,7aR)-2-[(4-pyridin-3-ylpyrimidin-2-yl)amino]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione (PubChem CID 7212190) has the molecular formula C17H17N5O2 and a molecular weight of 323.36 g/mol. Its IUPAC name is (3aR,7aR)-2-[(4-pyridin-3-ylpyrimidin-2-yl)amino]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione.
| Compound Name | (3aR,7aR)-2-[(4-pyridin-3-ylpyrimidin-2-yl)amino]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 7212190 |
| Molecular Formula | C17H17N5O2 |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | (3aR,7aR)-2-[(4-pyridin-3-ylpyrimidin-2-yl)amino]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
| SMILES | O=C1[C@@H]2CCCC[C@H]2C(=O)N1Nc1nccc(-c2cccnc2)n1 |
| InChI | InChI=1S/C17H17N5O2/c23-15-12-5-1-2-6-13(12)16(24)22(15)21-17-19-9-7-14(20-17)11-4-3-8-18-10-11/h3-4,7-10,12-13H,1-2,5-6H2,(H,19,20,21)/t12-,13-/m1/s1 |
| InChIKey | CHEMYJCVLBGJPO-CHWSQXEVSA-N |
| XLogP | 2.04 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|