About 8-oxo-5H-[1]benzofuro[3,2-b]quinoline-11-carboxylate
8-oxo-5H-[1]benzofuro[3,2-b]quinoline-11-carboxylate (PubChem CID 7213260) has the molecular formula C16H8NO4-
and a molecular weight of 278.24 g/mol. Its IUPAC name is 8-oxo-5H-[1]benzofuro[3,2-b]quinoline-11-carboxylate.
Molecular Properties
| Compound Name | 8-oxo-5H-[1]benzofuro[3,2-b]quinoline-11-carboxylate |
| PubChem CID | 7213260 |
| Molecular Formula | C16H8NO4- |
| Molecular Weight | 278.24 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | 8-oxo-5H-[1]benzofuro[3,2-b]quinoline-11-carboxylate |
| SMILES | O=C([O-])c1c2ccccc2[nH]c2c1oc1cc(=O)ccc12 |
| InChI | InChI=1S/C16H9NO4/c18-8-5-6-10-12(7-8)21-15-13(16(19)20)9-3-1-2-4-11(9)17-14(10)15/h1-7,17H,(H,19,20)/p-1 |
| InChIKey | HGONVYOYHUIPNV-UHFFFAOYSA-M |
| XLogP | 1.79 |
| TPSA | 86.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.24 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-oxo-5H-[1]benzofuro[3,2-b]quinoline-11-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-oxo-5H-[1]benzofuro[3,2-b]quinoline-11-carboxylate?
The IUPAC name of 8-oxo-5H-[1]benzofuro[3,2-b]quinoline-11-carboxylate (CID 7213260) is 8-oxo-5H-[1]benzofuro[3,2-b]quinoline-11-carboxylate.
What is the SMILES notation for 8-oxo-5H-[1]benzofuro[3,2-b]quinoline-11-carboxylate?
The canonical SMILES for 8-oxo-5H-[1]benzofuro[3,2-b]quinoline-11-carboxylate is O=C([O-])c1c2ccccc2[nH]c2c1oc1cc(=O)ccc12.
What is the InChIKey of 8-oxo-5H-[1]benzofuro[3,2-b]quinoline-11-carboxylate?
The InChIKey is HGONVYOYHUIPNV-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H9NO4/c18-8-5-6-10-12(7-8)21-15-13(16(19)20)9-3-1-2-4-11(9)17-14(10)15/h1-7,17H,(H,19,20)/p-1.
What are the key properties of 8-oxo-5H-[1]benzofuro[3,2-b]quinoline-11-carboxylate?
8-oxo-5H-[1]benzofuro[3,2-b]quinoline-11-carboxylate has a molecular weight of 278.24 g/mol, XLogP of 1.79, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-oxo-5H-[1]benzofuro[3,2-b]quinoline-11-carboxylate is sourced from PubChem (CID 7213260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).