About 4-chloro-2-ethoxyaniline
4-chloro-2-ethoxyaniline (PubChem CID 7213334) has the molecular formula C8H10ClNO
and a molecular weight of 171.63 g/mol. Its IUPAC name is 4-chloro-2-ethoxyaniline.
Molecular Properties
| Compound Name | 4-chloro-2-ethoxyaniline |
| PubChem CID | 7213334 |
| Molecular Formula | C8H10ClNO |
| Molecular Weight | 171.63 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | 4-chloro-2-ethoxyaniline |
| SMILES | CCOc1cc(Cl)ccc1N |
| InChI | InChI=1S/C8H10ClNO/c1-2-11-8-5-6(9)3-4-7(8)10/h3-5H,2,10H2,1H3 |
| InChIKey | MOJMJIHMADVVCQ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.63 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-2-ethoxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-ethoxyaniline?
The IUPAC name of 4-chloro-2-ethoxyaniline (CID 7213334) is 4-chloro-2-ethoxyaniline.
What is the SMILES notation for 4-chloro-2-ethoxyaniline?
The canonical SMILES for 4-chloro-2-ethoxyaniline is CCOc1cc(Cl)ccc1N.
What is the InChIKey of 4-chloro-2-ethoxyaniline?
The InChIKey is MOJMJIHMADVVCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10ClNO/c1-2-11-8-5-6(9)3-4-7(8)10/h3-5H,2,10H2,1H3.
What are the key properties of 4-chloro-2-ethoxyaniline?
4-chloro-2-ethoxyaniline has a molecular weight of 171.63 g/mol, XLogP of 2.32, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-ethoxyaniline is sourced from PubChem (CID 7213334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).