About (1Z)-1-(3-methyl-1,3-benzothiazol-2-ylidene)propane-2-thione
(1Z)-1-(3-methyl-1,3-benzothiazol-2-ylidene)propane-2-thione (PubChem CID 721517) has the molecular formula C11H11NS2
and a molecular weight of 221.35 g/mol. Its IUPAC name is (1Z)-1-(3-methyl-1,3-benzothiazol-2-ylidene)propane-2-thione.
Molecular Properties
| Compound Name | (1Z)-1-(3-methyl-1,3-benzothiazol-2-ylidene)propane-2-thione |
| PubChem CID | 721517 |
| Molecular Formula | C11H11NS2 |
| Molecular Weight | 221.35 g/mol |
| Exact Mass | 221.03 |
| IUPAC Name | (1Z)-1-(3-methyl-1,3-benzothiazol-2-ylidene)propane-2-thione |
| SMILES | CC(=S)/C=C1\Sc2ccccc2N1C |
| InChI | InChI=1S/C11H11NS2/c1-8(13)7-11-12(2)9-5-3-4-6-10(9)14-11/h3-7H,1-2H3/b11-7- |
| InChIKey | RJGXJDGXQRPPDM-XFFZJAGNSA-N |
| XLogP | 3.46 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.35 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (1Z)-1-(3-methyl-1,3-benzothiazol-2-ylidene)propane-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z)-1-(3-methyl-1,3-benzothiazol-2-ylidene)propane-2-thione?
The IUPAC name of (1Z)-1-(3-methyl-1,3-benzothiazol-2-ylidene)propane-2-thione (CID 721517) is (1Z)-1-(3-methyl-1,3-benzothiazol-2-ylidene)propane-2-thione.
What is the SMILES notation for (1Z)-1-(3-methyl-1,3-benzothiazol-2-ylidene)propane-2-thione?
The canonical SMILES for (1Z)-1-(3-methyl-1,3-benzothiazol-2-ylidene)propane-2-thione is CC(=S)/C=C1\Sc2ccccc2N1C.
What is the InChIKey of (1Z)-1-(3-methyl-1,3-benzothiazol-2-ylidene)propane-2-thione?
The InChIKey is RJGXJDGXQRPPDM-XFFZJAGNSA-N. The full InChI is InChI=1S/C11H11NS2/c1-8(13)7-11-12(2)9-5-3-4-6-10(9)14-11/h3-7H,1-2H3/b11-7-.
What are the key properties of (1Z)-1-(3-methyl-1,3-benzothiazol-2-ylidene)propane-2-thione?
(1Z)-1-(3-methyl-1,3-benzothiazol-2-ylidene)propane-2-thione has a molecular weight of 221.35 g/mol, XLogP of 3.46, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z)-1-(3-methyl-1,3-benzothiazol-2-ylidene)propane-2-thione is sourced from PubChem (CID 721517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).