About S-(4-fluorophenyl) benzenecarbothioate
S-(4-fluorophenyl) benzenecarbothioate (PubChem CID 721541) has the molecular formula C13H9FOS
and a molecular weight of 232.28 g/mol. Its IUPAC name is S-(4-fluorophenyl) benzenecarbothioate.
Molecular Properties
| Compound Name | S-(4-fluorophenyl) benzenecarbothioate |
| PubChem CID | 721541 |
| Molecular Formula | C13H9FOS |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.04 |
| IUPAC Name | S-(4-fluorophenyl) benzenecarbothioate |
| SMILES | O=C(Sc1ccc(F)cc1)c1ccccc1 |
| InChI | InChI=1S/C13H9FOS/c14-11-6-8-12(9-7-11)16-13(15)10-4-2-1-3-5-10/h1-9H |
| InChIKey | PSPAKOZZEZNWJV-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(4-fluorophenyl) benzenecarbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(4-fluorophenyl) benzenecarbothioate?
The IUPAC name of S-(4-fluorophenyl) benzenecarbothioate (CID 721541) is S-(4-fluorophenyl) benzenecarbothioate.
What is the SMILES notation for S-(4-fluorophenyl) benzenecarbothioate?
The canonical SMILES for S-(4-fluorophenyl) benzenecarbothioate is O=C(Sc1ccc(F)cc1)c1ccccc1.
What is the InChIKey of S-(4-fluorophenyl) benzenecarbothioate?
The InChIKey is PSPAKOZZEZNWJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9FOS/c14-11-6-8-12(9-7-11)16-13(15)10-4-2-1-3-5-10/h1-9H.
What are the key properties of S-(4-fluorophenyl) benzenecarbothioate?
S-(4-fluorophenyl) benzenecarbothioate has a molecular weight of 232.28 g/mol, XLogP of 3.76, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-(4-fluorophenyl) benzenecarbothioate is sourced from PubChem (CID 721541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).