C11H10NS2+ — CID 721556
5-phenyl-2,3-dihydro-[1,3]thiazolo[2,3-b][1,3]thiazol-4-ium (PubChem CID 721556) has the molecular formula C11H10NS2+ and a molecular weight of 220.34 g/mol. Its IUPAC name is 5-phenyl-2,3-dihydro-[1,3]thiazolo[2,3-b][1,3]thiazol-4-ium.
| Compound Name | 5-phenyl-2,3-dihydro-[1,3]thiazolo[2,3-b][1,3]thiazol-4-ium |
|---|---|
| PubChem CID | 721556 |
| Molecular Formula | C11H10NS2+ |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.02 |
| IUPAC Name | 5-phenyl-2,3-dihydro-[1,3]thiazolo[2,3-b][1,3]thiazol-4-ium |
| SMILES | c1ccc(-c2csc3[n+]2CCS3)cc1 |
| InChI | InChI=1S/C11H10NS2/c1-2-4-9(5-3-1)10-8-14-11-12(10)6-7-13-11/h1-5,8H,6-7H2/q+1 |
| InChIKey | AEOXCHHYMIGXRI-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|