C23H26N2O3 — CID 7215950
(1R,9S,12R)-10-ethyl-9-methyl-11-oxo-N-[(1S)-1-phenylethyl]-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene-12-carboxamide (PubChem CID 7215950) has the molecular formula C23H26N2O3 and a molecular weight of 378.47 g/mol. Its IUPAC name is (1R,9S,12R)-10-ethyl-9-methyl-11-oxo-N-[(1S)-1-phenylethyl]-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene-12-carboxamide.
| Compound Name | (1R,9S,12R)-10-ethyl-9-methyl-11-oxo-N-[(1S)-1-phenylethyl]-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene-12-carboxamide |
|---|---|
| PubChem CID | 7215950 |
| Molecular Formula | C23H26N2O3 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | (1R,9S,12R)-10-ethyl-9-methyl-11-oxo-N-[(1S)-1-phenylethyl]-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene-12-carboxamide |
| SMILES | CCN1C(=O)[C@@H](C(=O)N[C@@H](C)c2ccccc2)[C@H]2C[C@]1(C)Oc1ccccc12 |
| InChI | InChI=1S/C23H26N2O3/c1-4-25-22(27)20(21(26)24-15(2)16-10-6-5-7-11-16)18-14-23(25,3)28-19-13-9-8-12-17(18)19/h5-13,15,18,20H,4,14H2,1-3H3,(H,24,26)/t15-,18-,20+,23-/m0/s1 |
| InChIKey | IBJXYVQUQVHMFM-NRLYLRGFSA-N |
| XLogP | 3.62 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|