C17H21ClN6O — CID 7216285
4-N-(3-chloro-4-methylphenyl)-6-N-(3-methoxypropyl)-1-methylpyrazolo[3,4-d]pyrimidine-4,6-diamine (PubChem CID 7216285) has the molecular formula C17H21ClN6O and a molecular weight of 360.85 g/mol. Its IUPAC name is 4-N-(3-chloro-4-methylphenyl)-6-N-(3-methoxypropyl)-1-methylpyrazolo[3,4-d]pyrimidine-4,6-diamine.
| Compound Name | 4-N-(3-chloro-4-methylphenyl)-6-N-(3-methoxypropyl)-1-methylpyrazolo[3,4-d]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 7216285 |
| Molecular Formula | C17H21ClN6O |
| Molecular Weight | 360.85 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 4-N-(3-chloro-4-methylphenyl)-6-N-(3-methoxypropyl)-1-methylpyrazolo[3,4-d]pyrimidine-4,6-diamine |
| SMILES | COCCCNc1nc(Nc2ccc(C)c(Cl)c2)c2cnn(C)c2n1 |
| InChI | InChI=1S/C17H21ClN6O/c1-11-5-6-12(9-14(11)18)21-15-13-10-20-24(2)16(13)23-17(22-15)19-7-4-8-25-3/h5-6,9-10H,4,7-8H2,1-3H3,(H2,19,21,22,23) |
| InChIKey | YZYVUQMFLYNIMU-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 76.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.85 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|