About (3R)-3-amino-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one
(3R)-3-amino-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one (PubChem CID 7216757) has the molecular formula C16H15N3O
and a molecular weight of 265.32 g/mol. Its IUPAC name is (3R)-3-amino-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one.
Molecular Properties
| Compound Name | (3R)-3-amino-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one |
| PubChem CID | 7216757 |
| Molecular Formula | C16H15N3O |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | (3R)-3-amino-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one |
| SMILES | CN1C(=O)[C@H](N)N=C(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C16H15N3O/c1-19-13-10-6-5-9-12(13)14(18-15(17)16(19)20)11-7-3-2-4-8-11/h2-10,15H,17H2,1H3/t15-/m1/s1 |
| InChIKey | MWASGDJOVNIDEM-OAHLLOKOSA-N |
| XLogP | 1.79 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3R)-3-amino-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-amino-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one?
The IUPAC name of (3R)-3-amino-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one (CID 7216757) is (3R)-3-amino-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one.
What is the SMILES notation for (3R)-3-amino-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one?
The canonical SMILES for (3R)-3-amino-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one is CN1C(=O)[C@H](N)N=C(c2ccccc2)c2ccccc21.
What is the InChIKey of (3R)-3-amino-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one?
The InChIKey is MWASGDJOVNIDEM-OAHLLOKOSA-N. The full InChI is InChI=1S/C16H15N3O/c1-19-13-10-6-5-9-12(13)14(18-15(17)16(19)20)11-7-3-2-4-8-11/h2-10,15H,17H2,1H3/t15-/m1/s1.
What are the key properties of (3R)-3-amino-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one?
(3R)-3-amino-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one has a molecular weight of 265.32 g/mol, XLogP of 1.79, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-amino-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one is sourced from PubChem (CID 7216757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).