C12H17N4O4+ — CID 7219182
1-(6-methoxy-3-nitropyridin-1-ium-2-yl)piperidine-4-carboxamide (PubChem CID 7219182) has the molecular formula C12H17N4O4+ and a molecular weight of 281.29 g/mol. Its IUPAC name is 1-(6-methoxy-3-nitropyridin-1-ium-2-yl)piperidine-4-carboxamide.
| Compound Name | 1-(6-methoxy-3-nitropyridin-1-ium-2-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 7219182 |
| Molecular Formula | C12H17N4O4+ |
| Molecular Weight | 281.29 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 1-(6-methoxy-3-nitropyridin-1-ium-2-yl)piperidine-4-carboxamide |
| SMILES | COc1ccc([N+](=O)[O-])c(N2CCC(C(N)=O)CC2)[nH+]1 |
| InChI | InChI=1S/C12H16N4O4/c1-20-10-3-2-9(16(18)19)12(14-10)15-6-4-8(5-7-15)11(13)17/h2-3,8H,4-7H2,1H3,(H2,13,17)/p+1 |
| InChIKey | IXMYLJSZROHNPP-UHFFFAOYSA-O |
| XLogP | 0.12 |
| TPSA | 112.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.29 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|