C22H24N2O2 — CID 7219210
(Z,4R)-5-(4-tert-butylphenyl)-4-methyl-2-(4-nitrophenyl)pent-2-enenitrile (PubChem CID 7219210) has the molecular formula C22H24N2O2 and a molecular weight of 348.45 g/mol. Its IUPAC name is (Z,4R)-5-(4-tert-butylphenyl)-4-methyl-2-(4-nitrophenyl)pent-2-enenitrile.
| Compound Name | (Z,4R)-5-(4-tert-butylphenyl)-4-methyl-2-(4-nitrophenyl)pent-2-enenitrile |
|---|---|
| PubChem CID | 7219210 |
| Molecular Formula | C22H24N2O2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | (Z,4R)-5-(4-tert-butylphenyl)-4-methyl-2-(4-nitrophenyl)pent-2-enenitrile |
| SMILES | C[C@@H](/C=C(\C#N)c1ccc([N+](=O)[O-])cc1)Cc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C22H24N2O2/c1-16(13-17-5-9-20(10-6-17)22(2,3)4)14-19(15-23)18-7-11-21(12-8-18)24(25)26/h5-12,14,16H,13H2,1-4H3/b19-14+/t16-/m1/s1 |
| InChIKey | AKKLXACNANZOBZ-NISQSXRWSA-N |
| XLogP | 5.68 |
| TPSA | 66.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|