C9H11N2O3- — CID 7219734
6-(2-methylpropyl)-2-oxo-1H-pyrimidine-4-carboxylate (PubChem CID 7219734) has the molecular formula C9H11N2O3- and a molecular weight of 195.20 g/mol. Its IUPAC name is 6-(2-methylpropyl)-2-oxo-1H-pyrimidine-4-carboxylate.
| Compound Name | 6-(2-methylpropyl)-2-oxo-1H-pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 7219734 |
| Molecular Formula | C9H11N2O3- |
| Molecular Weight | 195.20 g/mol |
| Exact Mass | 195.08 |
| IUPAC Name | 6-(2-methylpropyl)-2-oxo-1H-pyrimidine-4-carboxylate |
| SMILES | CC(C)Cc1cc(C(=O)[O-])nc(=O)[nH]1 |
| InChI | InChI=1S/C9H12N2O3/c1-5(2)3-6-4-7(8(12)13)11-9(14)10-6/h4-5H,3H2,1-2H3,(H,12,13)(H,10,11,14)/p-1 |
| InChIKey | WDIFSCKLWBVBLR-UHFFFAOYSA-M |
| XLogP | -0.67 |
| TPSA | 85.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.20 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |