C12H11N2O3- — CID 7219874
5-(4-methoxyphenyl)-1-methylpyrazole-3-carboxylate (PubChem CID 7219874) has the molecular formula C12H11N2O3- and a molecular weight of 231.23 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-1-methylpyrazole-3-carboxylate.
| Compound Name | 5-(4-methoxyphenyl)-1-methylpyrazole-3-carboxylate |
|---|---|
| PubChem CID | 7219874 |
| Molecular Formula | C12H11N2O3- |
| Molecular Weight | 231.23 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | 5-(4-methoxyphenyl)-1-methylpyrazole-3-carboxylate |
| SMILES | COc1ccc(-c2cc(C(=O)[O-])nn2C)cc1 |
| InChI | InChI=1S/C12H12N2O3/c1-14-11(7-10(13-14)12(15)16)8-3-5-9(17-2)6-4-8/h3-7H,1-2H3,(H,15,16)/p-1 |
| InChIKey | SMMCMCIJHBQWLN-UHFFFAOYSA-M |
| XLogP | 0.46 |
| TPSA | 67.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.23 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |