About 2-(2,4-dioxoimidazolidin-1-yl)acetate
2-(2,4-dioxoimidazolidin-1-yl)acetate (PubChem CID 7219893) has the molecular formula C5H5N2O4-
and a molecular weight of 157.10 g/mol. Its IUPAC name is 2-(2,4-dioxoimidazolidin-1-yl)acetate.
Molecular Properties
| Compound Name | 2-(2,4-dioxoimidazolidin-1-yl)acetate |
| PubChem CID | 7219893 |
| Molecular Formula | C5H5N2O4- |
| Molecular Weight | 157.10 g/mol |
| Exact Mass | 157.03 |
| IUPAC Name | 2-(2,4-dioxoimidazolidin-1-yl)acetate |
| SMILES | O=C([O-])CN1CC(=O)NC1=O |
| InChI | InChI=1S/C5H6N2O4/c8-3-1-7(2-4(9)10)5(11)6-3/h1-2H2,(H,9,10)(H,6,8,11)/p-1 |
| InChIKey | MYXWHYDWUWIFRA-UHFFFAOYSA-M |
| XLogP | -2.71 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.10 |
| LogP ≤ 5 | -2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,4-dioxoimidazolidin-1-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4-dioxoimidazolidin-1-yl)acetate?
The IUPAC name of 2-(2,4-dioxoimidazolidin-1-yl)acetate (CID 7219893) is 2-(2,4-dioxoimidazolidin-1-yl)acetate.
What is the SMILES notation for 2-(2,4-dioxoimidazolidin-1-yl)acetate?
The canonical SMILES for 2-(2,4-dioxoimidazolidin-1-yl)acetate is O=C([O-])CN1CC(=O)NC1=O.
What is the InChIKey of 2-(2,4-dioxoimidazolidin-1-yl)acetate?
The InChIKey is MYXWHYDWUWIFRA-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H6N2O4/c8-3-1-7(2-4(9)10)5(11)6-3/h1-2H2,(H,9,10)(H,6,8,11)/p-1.
What are the key properties of 2-(2,4-dioxoimidazolidin-1-yl)acetate?
2-(2,4-dioxoimidazolidin-1-yl)acetate has a molecular weight of 157.10 g/mol, XLogP of -2.71, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-dioxoimidazolidin-1-yl)acetate is sourced from PubChem (CID 7219893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).