C11H16NO8- — CID 72199686
(2R,3aR,6R,7R,7aR)-2-[(2S)-2-azaniumyl-2-carboxylatoethyl]-6,7-dihydroxy-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-carboxylate (PubChem CID 72199686) has the molecular formula C11H16NO8- and a molecular weight of 290.25 g/mol. Its IUPAC name is (2R,3aR,6R,7R,7aR)-2-[(2S)-2-azaniumyl-2-carboxylatoethyl]-6,7-dihydroxy-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-carboxylate.
| Compound Name | (2R,3aR,6R,7R,7aR)-2-[(2S)-2-azaniumyl-2-carboxylatoethyl]-6,7-dihydroxy-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-carboxylate |
|---|---|
| PubChem CID | 72199686 |
| Molecular Formula | C11H16NO8- |
| Molecular Weight | 290.25 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | (2R,3aR,6R,7R,7aR)-2-[(2S)-2-azaniumyl-2-carboxylatoethyl]-6,7-dihydroxy-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-carboxylate |
| SMILES | C1[C@@H]2[C@@H]([C@@H]([C@@H](CO2)O)O)O[C@@]1(C[C@@H](C(=O)[O-])[NH3+])C(=O)[O-] |
| InChI | InChI=1S/C11H17NO8/c12-4(9(15)16)1-11(10(17)18)2-6-8(20-11)7(14)5(13)3-19-6/h4-8,13-14H,1-3,12H2,(H,15,16)(H,17,18)/p-1/t4-,5+,6+,7+,8-,11+/m0/s1 |
| InChIKey | NRTJEXLNSCGBJU-FQYLSUDWSA-M |
| XLogP | -3.80 |
| TPSA | 167.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | 404 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.25 |
| LogP ≤ 5 | -3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |