About (3S)-3-(2,6-dichlorophenyl)-2-nitro-3H-benzo[f]chromene
(3S)-3-(2,6-dichlorophenyl)-2-nitro-3H-benzo[f]chromene (PubChem CID 7221489) has the molecular formula C19H11Cl2NO3
and a molecular weight of 372.21 g/mol. Its IUPAC name is (3S)-3-(2,6-dichlorophenyl)-2-nitro-3H-benzo[f]chromene.
Molecular Properties
| Compound Name | (3S)-3-(2,6-dichlorophenyl)-2-nitro-3H-benzo[f]chromene |
| PubChem CID | 7221489 |
| Molecular Formula | C19H11Cl2NO3 |
| Molecular Weight | 372.21 g/mol |
| Exact Mass | 371.01 |
| IUPAC Name | (3S)-3-(2,6-dichlorophenyl)-2-nitro-3H-benzo[f]chromene |
| SMILES | O=[N+]([O-])C1=Cc2c(ccc3ccccc23)O[C@H]1c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C19H11Cl2NO3/c20-14-6-3-7-15(21)18(14)19-16(22(23)24)10-13-12-5-2-1-4-11(12)8-9-17(13)25-19/h1-10,19H/t19-/m1/s1 |
| InChIKey | QDGLOAMKOHXCSD-LJQANCHMSA-N |
| XLogP | 5.90 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.21 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (3S)-3-(2,6-dichlorophenyl)-2-nitro-3H-benzo[f]chromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-(2,6-dichlorophenyl)-2-nitro-3H-benzo[f]chromene?
The IUPAC name of (3S)-3-(2,6-dichlorophenyl)-2-nitro-3H-benzo[f]chromene (CID 7221489) is (3S)-3-(2,6-dichlorophenyl)-2-nitro-3H-benzo[f]chromene.
What is the SMILES notation for (3S)-3-(2,6-dichlorophenyl)-2-nitro-3H-benzo[f]chromene?
The canonical SMILES for (3S)-3-(2,6-dichlorophenyl)-2-nitro-3H-benzo[f]chromene is O=[N+]([O-])C1=Cc2c(ccc3ccccc23)O[C@H]1c1c(Cl)cccc1Cl.
What is the InChIKey of (3S)-3-(2,6-dichlorophenyl)-2-nitro-3H-benzo[f]chromene?
The InChIKey is QDGLOAMKOHXCSD-LJQANCHMSA-N. The full InChI is InChI=1S/C19H11Cl2NO3/c20-14-6-3-7-15(21)18(14)19-16(22(23)24)10-13-12-5-2-1-4-11(12)8-9-17(13)25-19/h1-10,19H/t19-/m1/s1.
What are the key properties of (3S)-3-(2,6-dichlorophenyl)-2-nitro-3H-benzo[f]chromene?
(3S)-3-(2,6-dichlorophenyl)-2-nitro-3H-benzo[f]chromene has a molecular weight of 372.21 g/mol, XLogP of 5.90, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-(2,6-dichlorophenyl)-2-nitro-3H-benzo[f]chromene is sourced from PubChem (CID 7221489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).