C17H19Cl2NOS — CID 7222054
(2S)-1-[(3-chlorophenyl)methylamino]-3-(4-chlorophenyl)sulfanyl-2-methylpropan-2-ol (PubChem CID 7222054) has the molecular formula C17H19Cl2NOS and a molecular weight of 356.32 g/mol. Its IUPAC name is (2S)-1-[(3-chlorophenyl)methylamino]-3-(4-chlorophenyl)sulfanyl-2-methylpropan-2-ol.
| Compound Name | (2S)-1-[(3-chlorophenyl)methylamino]-3-(4-chlorophenyl)sulfanyl-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 7222054 |
| Molecular Formula | C17H19Cl2NOS |
| Molecular Weight | 356.32 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | (2S)-1-[(3-chlorophenyl)methylamino]-3-(4-chlorophenyl)sulfanyl-2-methylpropan-2-ol |
| SMILES | C[C@](O)(CNCc1cccc(Cl)c1)CSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H19Cl2NOS/c1-17(21,12-22-16-7-5-14(18)6-8-16)11-20-10-13-3-2-4-15(19)9-13/h2-9,20-21H,10-12H2,1H3/t17-/m0/s1 |
| InChIKey | NOWSUNYLXMJGOL-KRWDZBQOSA-N |
| XLogP | 4.63 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.32 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |