C14H17F6N3O — CID 7222351
N-[3-cyano-1,1,1-trifluoro-4-imino-2-(trifluoromethyl)pentan-2-yl]cyclohexanecarboxamide (PubChem CID 7222351) has the molecular formula C14H17F6N3O and a molecular weight of 357.30 g/mol. Its IUPAC name is N-[3-cyano-1,1,1-trifluoro-4-imino-2-(trifluoromethyl)pentan-2-yl]cyclohexanecarboxamide.
| Compound Name | N-[3-cyano-1,1,1-trifluoro-4-imino-2-(trifluoromethyl)pentan-2-yl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 7222351 |
| Molecular Formula | C14H17F6N3O |
| Molecular Weight | 357.30 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | N-[3-cyano-1,1,1-trifluoro-4-imino-2-(trifluoromethyl)pentan-2-yl]cyclohexanecarboxamide |
| SMILES | [H]/N=C(\C)C(C#N)C(NC(=O)C1CCCCC1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H17F6N3O/c1-8(22)10(7-21)12(13(15,16)17,14(18,19)20)23-11(24)9-5-3-2-4-6-9/h9-10,22H,2-6H2,1H3,(H,23,24)/b22-8+ |
| InChIKey | ZBHDZCLUHHKSLH-GZIVZEMBSA-N |
| XLogP | 3.73 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.30 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|