C18H25N3O3S — CID 7222361
(5R)-1-[2-(cyclohexen-1-yl)ethyl]-5-[[(2R)-oxolan-2-yl]methyliminomethyl]-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 7222361) has the molecular formula C18H25N3O3S and a molecular weight of 363.48 g/mol. Its IUPAC name is (5R)-1-[2-(cyclohexen-1-yl)ethyl]-5-[[(2R)-oxolan-2-yl]methyliminomethyl]-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | (5R)-1-[2-(cyclohexen-1-yl)ethyl]-5-[[(2R)-oxolan-2-yl]methyliminomethyl]-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 7222361 |
| Molecular Formula | C18H25N3O3S |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | (5R)-1-[2-(cyclohexen-1-yl)ethyl]-5-[[(2R)-oxolan-2-yl]methyliminomethyl]-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | O=C1NC(=S)N(CCC2=CCCCC2)C(=O)[C@@H]1/C=N/C[C@H]1CCCO1 |
| InChI | InChI=1S/C18H25N3O3S/c22-16-15(12-19-11-14-7-4-10-24-14)17(23)21(18(25)20-16)9-8-13-5-2-1-3-6-13/h5,12,14-15H,1-4,6-11H2,(H,20,22,25)/b19-12+/t14-,15-/m1/s1 |
| InChIKey | ADLLPWYBGXDVIG-QCSDQTOZSA-N |
| XLogP | 1.99 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|