C14H12N2+2 — CID 722265
1,4-diazoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),4,6,8(16),9,11(15),12-heptaene (PubChem CID 722265) has the molecular formula C14H12N2+2 and a molecular weight of 208.26 g/mol. Its IUPAC name is 1,4-diazoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),4,6,8(16),9,11(15),12-heptaene.
| Compound Name | 1,4-diazoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),4,6,8(16),9,11(15),12-heptaene |
|---|---|
| PubChem CID | 722265 |
| Molecular Formula | C14H12N2+2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 1,4-diazoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),4,6,8(16),9,11(15),12-heptaene |
| SMILES | c1cc2ccc3ccc[n+]4c3c2[n+](c1)CC4 |
| InChI | InChI=1S/C14H12N2/c1-3-11-5-6-12-4-2-8-16-10-9-15(7-1)13(11)14(12)16/h1-8H,9-10H2/q+2 |
| InChIKey | PUSYDLRAPRZFQW-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|