C23H25N3O3S — CID 7222985
N'-(3,5-dimethylphenyl)-N-[2-[2-(4-methoxyphenyl)-4-methyl-1,3-thiazol-5-yl]ethyl]oxamide (PubChem CID 7222985) has the molecular formula C23H25N3O3S and a molecular weight of 423.54 g/mol. Its IUPAC name is N'-(3,5-dimethylphenyl)-N-[2-[2-(4-methoxyphenyl)-4-methyl-1,3-thiazol-5-yl]ethyl]oxamide.
| Compound Name | N'-(3,5-dimethylphenyl)-N-[2-[2-(4-methoxyphenyl)-4-methyl-1,3-thiazol-5-yl]ethyl]oxamide |
|---|---|
| PubChem CID | 7222985 |
| Molecular Formula | C23H25N3O3S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | N'-(3,5-dimethylphenyl)-N-[2-[2-(4-methoxyphenyl)-4-methyl-1,3-thiazol-5-yl]ethyl]oxamide |
| SMILES | COc1ccc(-c2nc(C)c(CCNC(=O)C(=O)Nc3cc(C)cc(C)c3)s2)cc1 |
| InChI | InChI=1S/C23H25N3O3S/c1-14-11-15(2)13-18(12-14)26-22(28)21(27)24-10-9-20-16(3)25-23(30-20)17-5-7-19(29-4)8-6-17/h5-8,11-13H,9-10H2,1-4H3,(H,24,27)(H,26,28) |
| InChIKey | PKNMFPASMPUAGU-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|