About N-ethyl-N-phenyl-2,3-dihydro-1,4-benzodioxine-6-sulfonamide
N-ethyl-N-phenyl-2,3-dihydro-1,4-benzodioxine-6-sulfonamide (PubChem CID 722337) has the molecular formula C16H17NO4S
and a molecular weight of 319.38 g/mol. Its IUPAC name is N-ethyl-N-phenyl-2,3-dihydro-1,4-benzodioxine-6-sulfonamide.
Molecular Properties
| Compound Name | N-ethyl-N-phenyl-2,3-dihydro-1,4-benzodioxine-6-sulfonamide |
| PubChem CID | 722337 |
| Molecular Formula | C16H17NO4S |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | N-ethyl-N-phenyl-2,3-dihydro-1,4-benzodioxine-6-sulfonamide |
| SMILES | CCN(c1ccccc1)S(=O)(=O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C16H17NO4S/c1-2-17(13-6-4-3-5-7-13)22(18,19)14-8-9-15-16(12-14)21-11-10-20-15/h3-9,12H,2,10-11H2,1H3 |
| InChIKey | ILGNDZBMRABVSX-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-ethyl-N-phenyl-2,3-dihydro-1,4-benzodioxine-6-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-phenyl-2,3-dihydro-1,4-benzodioxine-6-sulfonamide?
The IUPAC name of N-ethyl-N-phenyl-2,3-dihydro-1,4-benzodioxine-6-sulfonamide (CID 722337) is N-ethyl-N-phenyl-2,3-dihydro-1,4-benzodioxine-6-sulfonamide.
What is the SMILES notation for N-ethyl-N-phenyl-2,3-dihydro-1,4-benzodioxine-6-sulfonamide?
The canonical SMILES for N-ethyl-N-phenyl-2,3-dihydro-1,4-benzodioxine-6-sulfonamide is CCN(c1ccccc1)S(=O)(=O)c1ccc2c(c1)OCCO2.
What is the InChIKey of N-ethyl-N-phenyl-2,3-dihydro-1,4-benzodioxine-6-sulfonamide?
The InChIKey is ILGNDZBMRABVSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NO4S/c1-2-17(13-6-4-3-5-7-13)22(18,19)14-8-9-15-16(12-14)21-11-10-20-15/h3-9,12H,2,10-11H2,1H3.
What are the key properties of N-ethyl-N-phenyl-2,3-dihydro-1,4-benzodioxine-6-sulfonamide?
N-ethyl-N-phenyl-2,3-dihydro-1,4-benzodioxine-6-sulfonamide has a molecular weight of 319.38 g/mol, XLogP of 2.67, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-phenyl-2,3-dihydro-1,4-benzodioxine-6-sulfonamide is sourced from PubChem (CID 722337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).