C22H25N5OS+2 — CID 7223781
[(1R,4S,4aS)-1,3,3-tricyano-4-[4-(morpholin-4-ium-4-ylmethyl)thiophen-2-yl]-1,4,4a,5,6,7-hexahydronaphthalen-2-ylidene]azanium (PubChem CID 7223781) has the molecular formula C22H25N5OS+2 and a molecular weight of 407.54 g/mol. Its IUPAC name is [(1R,4S,4aS)-1,3,3-tricyano-4-[4-(morpholin-4-ium-4-ylmethyl)thiophen-2-yl]-1,4,4a,5,6,7-hexahydronaphthalen-2-ylidene]azanium.
| Compound Name | [(1R,4S,4aS)-1,3,3-tricyano-4-[4-(morpholin-4-ium-4-ylmethyl)thiophen-2-yl]-1,4,4a,5,6,7-hexahydronaphthalen-2-ylidene]azanium |
|---|---|
| PubChem CID | 7223781 |
| Molecular Formula | C22H25N5OS+2 |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | [(1R,4S,4aS)-1,3,3-tricyano-4-[4-(morpholin-4-ium-4-ylmethyl)thiophen-2-yl]-1,4,4a,5,6,7-hexahydronaphthalen-2-ylidene]azanium |
| SMILES | N#C[C@H]1C(=[NH2+])C(C#N)(C#N)[C@@H](c2cc(C[NH+]3CCOCC3)cs2)[C@@H]2CCCC=C12 |
| InChI | InChI=1S/C22H23N5OS/c23-10-18-16-3-1-2-4-17(16)20(22(13-24,14-25)21(18)26)19-9-15(12-29-19)11-27-5-7-28-8-6-27/h3,9,12,17-18,20,26H,1-2,4-8,11H2/p+2/t17-,18-,20-/m1/s1 |
| InChIKey | CBXGIAXPMUJRLU-QWFCFKBJSA-P |
| XLogP | 0.36 |
| TPSA | 110.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|