C21H23BrN2O — CID 7223858
N-[(1S,5S)-8-benzyl-8-azabicyclo[3.2.1]octan-3-yl]-2-bromobenzamide (PubChem CID 7223858) has the molecular formula C21H23BrN2O and a molecular weight of 399.33 g/mol. Its IUPAC name is N-[(1S,5S)-8-benzyl-8-azabicyclo[3.2.1]octan-3-yl]-2-bromobenzamide.
| Compound Name | N-[(1S,5S)-8-benzyl-8-azabicyclo[3.2.1]octan-3-yl]-2-bromobenzamide |
|---|---|
| PubChem CID | 7223858 |
| Molecular Formula | C21H23BrN2O |
| Molecular Weight | 399.33 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | N-[(1S,5S)-8-benzyl-8-azabicyclo[3.2.1]octan-3-yl]-2-bromobenzamide |
| SMILES | O=C(NC1C[C@@H]2CC[C@@H](C1)N2Cc1ccccc1)c1ccccc1Br |
| InChI | InChI=1S/C21H23BrN2O/c22-20-9-5-4-8-19(20)21(25)23-16-12-17-10-11-18(13-16)24(17)14-15-6-2-1-3-7-15/h1-9,16-18H,10-14H2,(H,23,25)/t17-,18-/m0/s1 |
| InChIKey | GLMCDAQNMFUABE-ROUUACIJSA-N |
| XLogP | 4.37 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.33 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |