C22H25N3O3 — CID 7224377
[2-oxo-2-(5-phenyl-3,4-dihydropyrazol-2-yl)ethyl] 2-(butylamino)benzoate (PubChem CID 7224377) has the molecular formula C22H25N3O3 and a molecular weight of 379.46 g/mol. Its IUPAC name is [2-oxo-2-(5-phenyl-3,4-dihydropyrazol-2-yl)ethyl] 2-(butylamino)benzoate.
| Compound Name | [2-oxo-2-(5-phenyl-3,4-dihydropyrazol-2-yl)ethyl] 2-(butylamino)benzoate |
|---|---|
| PubChem CID | 7224377 |
| Molecular Formula | C22H25N3O3 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | [2-oxo-2-(5-phenyl-3,4-dihydropyrazol-2-yl)ethyl] 2-(butylamino)benzoate |
| SMILES | CCCCNc1ccccc1C(=O)OCC(=O)N1CCC(c2ccccc2)=N1 |
| InChI | InChI=1S/C22H25N3O3/c1-2-3-14-23-20-12-8-7-11-18(20)22(27)28-16-21(26)25-15-13-19(24-25)17-9-5-4-6-10-17/h4-12,23H,2-3,13-16H2,1H3 |
| InChIKey | GPDQZGPBTISMCU-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|