C23H27N3O2S — CID 7224396
2-[1-(4-ethoxyphenyl)benzimidazol-2-yl]sulfanyl-1-[(2S)-2-methylpiperidin-1-yl]ethanone (PubChem CID 7224396) has the molecular formula C23H27N3O2S and a molecular weight of 409.56 g/mol. Its IUPAC name is 2-[1-(4-ethoxyphenyl)benzimidazol-2-yl]sulfanyl-1-[(2S)-2-methylpiperidin-1-yl]ethanone.
| Compound Name | 2-[1-(4-ethoxyphenyl)benzimidazol-2-yl]sulfanyl-1-[(2S)-2-methylpiperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 7224396 |
| Molecular Formula | C23H27N3O2S |
| Molecular Weight | 409.56 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | 2-[1-(4-ethoxyphenyl)benzimidazol-2-yl]sulfanyl-1-[(2S)-2-methylpiperidin-1-yl]ethanone |
| SMILES | CCOc1ccc(-n2c(SCC(=O)N3CCCC[C@@H]3C)nc3ccccc32)cc1 |
| InChI | InChI=1S/C23H27N3O2S/c1-3-28-19-13-11-18(12-14-19)26-21-10-5-4-9-20(21)24-23(26)29-16-22(27)25-15-7-6-8-17(25)2/h4-5,9-14,17H,3,6-8,15-16H2,1-2H3/t17-/m0/s1 |
| InChIKey | ZVJWERMKBDPYJW-KRWDZBQOSA-N |
| XLogP | 4.92 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.56 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |