C16H19Cl3N3O3+ — CID 7224680
[2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] 4-amino-3,5,6-trichloropyridin-1-ium-2-carboxylate (PubChem CID 7224680) has the molecular formula C16H19Cl3N3O3+ and a molecular weight of 407.71 g/mol. Its IUPAC name is [2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] 4-amino-3,5,6-trichloropyridin-1-ium-2-carboxylate.
| Compound Name | [2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] 4-amino-3,5,6-trichloropyridin-1-ium-2-carboxylate |
|---|---|
| PubChem CID | 7224680 |
| Molecular Formula | C16H19Cl3N3O3+ |
| Molecular Weight | 407.71 g/mol |
| Exact Mass | 406.05 |
| IUPAC Name | [2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] 4-amino-3,5,6-trichloropyridin-1-ium-2-carboxylate |
| SMILES | Nc1c(Cl)c(Cl)[nH+]c(C(=O)OCC(=O)NCCC2=CCCCC2)c1Cl |
| InChI | InChI=1S/C16H18Cl3N3O3/c17-11-13(20)12(18)15(19)22-14(11)16(24)25-8-10(23)21-7-6-9-4-2-1-3-5-9/h4H,1-3,5-8H2,(H2,20,22)(H,21,23)/p+1 |
| InChIKey | YUBWOXVIWGNHEM-UHFFFAOYSA-O |
| XLogP | 3.21 |
| TPSA | 95.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.71 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|