About (4-methylphenyl)thiourea
(4-methylphenyl)thiourea (PubChem CID 722833) has the molecular formula C8H10N2S
and a molecular weight of 166.25 g/mol. Its IUPAC name is (4-methylphenyl)thiourea.
Molecular Properties
| Compound Name | (4-methylphenyl)thiourea |
| PubChem CID | 722833 |
| Molecular Formula | C8H10N2S |
| Molecular Weight | 166.25 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | (4-methylphenyl)thiourea |
| SMILES | Cc1ccc(NC(N)=S)cc1 |
| InChI | InChI=1S/C8H10N2S/c1-6-2-4-7(5-3-6)10-8(9)11/h2-5H,1H3,(H3,9,10,11) |
| InChIKey | VXLFMCZPFIKKDZ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.25 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (4-methylphenyl)thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methylphenyl)thiourea?
The IUPAC name of (4-methylphenyl)thiourea (CID 722833) is (4-methylphenyl)thiourea.
What is the SMILES notation for (4-methylphenyl)thiourea?
The canonical SMILES for (4-methylphenyl)thiourea is Cc1ccc(NC(N)=S)cc1.
What is the InChIKey of (4-methylphenyl)thiourea?
The InChIKey is VXLFMCZPFIKKDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2S/c1-6-2-4-7(5-3-6)10-8(9)11/h2-5H,1H3,(H3,9,10,11).
What are the key properties of (4-methylphenyl)thiourea?
(4-methylphenyl)thiourea has a molecular weight of 166.25 g/mol, XLogP of 1.65, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methylphenyl)thiourea is sourced from PubChem (CID 722833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).