About [5-(4-chlorophenyl)-1,2-oxazol-4-yl]-phenyldiazene
[5-(4-chlorophenyl)-1,2-oxazol-4-yl]-phenyldiazene (PubChem CID 7230530) has the molecular formula C15H10ClN3O
and a molecular weight of 283.72 g/mol. Its IUPAC name is [5-(4-chlorophenyl)-1,2-oxazol-4-yl]-phenyldiazene.
Molecular Properties
| Compound Name | [5-(4-chlorophenyl)-1,2-oxazol-4-yl]-phenyldiazene |
| PubChem CID | 7230530 |
| Molecular Formula | C15H10ClN3O |
| Molecular Weight | 283.72 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | [5-(4-chlorophenyl)-1,2-oxazol-4-yl]-phenyldiazene |
| SMILES | Clc1ccc(-c2oncc2/N=N/c2ccccc2)cc1 |
| InChI | InChI=1S/C15H10ClN3O/c16-12-8-6-11(7-9-12)15-14(10-17-20-15)19-18-13-4-2-1-3-5-13/h1-10H/b19-18+ |
| InChIKey | MPRUAZFKOKNIFD-VHEBQXMUSA-N |
| XLogP | 5.41 |
| TPSA | 50.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 283.72 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze [5-(4-chlorophenyl)-1,2-oxazol-4-yl]-phenyldiazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(4-chlorophenyl)-1,2-oxazol-4-yl]-phenyldiazene?
The IUPAC name of [5-(4-chlorophenyl)-1,2-oxazol-4-yl]-phenyldiazene (CID 7230530) is [5-(4-chlorophenyl)-1,2-oxazol-4-yl]-phenyldiazene.
What is the SMILES notation for [5-(4-chlorophenyl)-1,2-oxazol-4-yl]-phenyldiazene?
The canonical SMILES for [5-(4-chlorophenyl)-1,2-oxazol-4-yl]-phenyldiazene is Clc1ccc(-c2oncc2/N=N/c2ccccc2)cc1.
What is the InChIKey of [5-(4-chlorophenyl)-1,2-oxazol-4-yl]-phenyldiazene?
The InChIKey is MPRUAZFKOKNIFD-VHEBQXMUSA-N. The full InChI is InChI=1S/C15H10ClN3O/c16-12-8-6-11(7-9-12)15-14(10-17-20-15)19-18-13-4-2-1-3-5-13/h1-10H/b19-18+.
What are the key properties of [5-(4-chlorophenyl)-1,2-oxazol-4-yl]-phenyldiazene?
[5-(4-chlorophenyl)-1,2-oxazol-4-yl]-phenyldiazene has a molecular weight of 283.72 g/mol, XLogP of 5.41, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(4-chlorophenyl)-1,2-oxazol-4-yl]-phenyldiazene is sourced from PubChem (CID 7230530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).