About 4-(1,3-benzothiazol-2-yldisulfanyl)morpholine
4-(1,3-benzothiazol-2-yldisulfanyl)morpholine (PubChem CID 7231) has the molecular formula C11H12N2OS3
and a molecular weight of 284.43 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-yldisulfanyl)morpholine.
Molecular Properties
| Compound Name | 4-(1,3-benzothiazol-2-yldisulfanyl)morpholine |
| PubChem CID | 7231 |
| Molecular Formula | C11H12N2OS3 |
| Molecular Weight | 284.43 g/mol |
| Exact Mass | 284.01 |
| IUPAC Name | 4-(1,3-benzothiazol-2-yldisulfanyl)morpholine |
| SMILES | c1ccc2sc(SSN3CCOCC3)nc2c1 |
| InChI | InChI=1S/C11H12N2OS3/c1-2-4-10-9(3-1)12-11(15-10)16-17-13-5-7-14-8-6-13/h1-4H,5-8H2 |
| InChIKey | QRYFCNPYGUORTK-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.43 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(1,3-benzothiazol-2-yldisulfanyl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3-benzothiazol-2-yldisulfanyl)morpholine?
The IUPAC name of 4-(1,3-benzothiazol-2-yldisulfanyl)morpholine (CID 7231) is 4-(1,3-benzothiazol-2-yldisulfanyl)morpholine.
What is the SMILES notation for 4-(1,3-benzothiazol-2-yldisulfanyl)morpholine?
The canonical SMILES for 4-(1,3-benzothiazol-2-yldisulfanyl)morpholine is c1ccc2sc(SSN3CCOCC3)nc2c1.
What is the InChIKey of 4-(1,3-benzothiazol-2-yldisulfanyl)morpholine?
The InChIKey is QRYFCNPYGUORTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2OS3/c1-2-4-10-9(3-1)12-11(15-10)16-17-13-5-7-14-8-6-13/h1-4H,5-8H2.
What are the key properties of 4-(1,3-benzothiazol-2-yldisulfanyl)morpholine?
4-(1,3-benzothiazol-2-yldisulfanyl)morpholine has a molecular weight of 284.43 g/mol, XLogP of 3.28, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-benzothiazol-2-yldisulfanyl)morpholine is sourced from PubChem (CID 7231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).