About N-ethyl-N-[[(5R)-3-(4-methylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]benzenesulfonamide
N-ethyl-N-[[(5R)-3-(4-methylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]benzenesulfonamide (PubChem CID 7231252) has the molecular formula C19H22N2O3S
and a molecular weight of 358.46 g/mol. Its IUPAC name is N-ethyl-N-[[(5R)-3-(4-methylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]benzenesulfonamide.
Molecular Properties
| Compound Name | N-ethyl-N-[[(5R)-3-(4-methylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]benzenesulfonamide |
| PubChem CID | 7231252 |
| Molecular Formula | C19H22N2O3S |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | N-ethyl-N-[[(5R)-3-(4-methylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]benzenesulfonamide |
| SMILES | CCN(C[C@H]1CC(c2ccc(C)cc2)=NO1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H22N2O3S/c1-3-21(25(22,23)18-7-5-4-6-8-18)14-17-13-19(20-24-17)16-11-9-15(2)10-12-16/h4-12,17H,3,13-14H2,1-2H3/t17-/m1/s1 |
| InChIKey | JLIRAMMKSLBQIP-QGZVFWFLSA-N |
| XLogP | 3.20 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-ethyl-N-[[(5R)-3-(4-methylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-[[(5R)-3-(4-methylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]benzenesulfonamide?
The IUPAC name of N-ethyl-N-[[(5R)-3-(4-methylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]benzenesulfonamide (CID 7231252) is N-ethyl-N-[[(5R)-3-(4-methylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]benzenesulfonamide.
What is the SMILES notation for N-ethyl-N-[[(5R)-3-(4-methylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]benzenesulfonamide?
The canonical SMILES for N-ethyl-N-[[(5R)-3-(4-methylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]benzenesulfonamide is CCN(C[C@H]1CC(c2ccc(C)cc2)=NO1)S(=O)(=O)c1ccccc1.
What is the InChIKey of N-ethyl-N-[[(5R)-3-(4-methylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]benzenesulfonamide?
The InChIKey is JLIRAMMKSLBQIP-QGZVFWFLSA-N. The full InChI is InChI=1S/C19H22N2O3S/c1-3-21(25(22,23)18-7-5-4-6-8-18)14-17-13-19(20-24-17)16-11-9-15(2)10-12-16/h4-12,17H,3,13-14H2,1-2H3/t17-/m1/s1.
What are the key properties of N-ethyl-N-[[(5R)-3-(4-methylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]benzenesulfonamide?
N-ethyl-N-[[(5R)-3-(4-methylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]benzenesulfonamide has a molecular weight of 358.46 g/mol, XLogP of 3.20, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-[[(5R)-3-(4-methylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]benzenesulfonamide is sourced from PubChem (CID 7231252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).