C22H29N3O2 — CID 7232057
(4S)-6-butyl-1-prop-2-enyl-4-(2,4,5-trimethylphenyl)-4,7-dihydro-3H-pyrrolo[3,4-d]pyrimidine-2,5-dione (PubChem CID 7232057) has the molecular formula C22H29N3O2 and a molecular weight of 367.49 g/mol. Its IUPAC name is (4S)-6-butyl-1-prop-2-enyl-4-(2,4,5-trimethylphenyl)-4,7-dihydro-3H-pyrrolo[3,4-d]pyrimidine-2,5-dione.
| Compound Name | (4S)-6-butyl-1-prop-2-enyl-4-(2,4,5-trimethylphenyl)-4,7-dihydro-3H-pyrrolo[3,4-d]pyrimidine-2,5-dione |
|---|---|
| PubChem CID | 7232057 |
| Molecular Formula | C22H29N3O2 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | (4S)-6-butyl-1-prop-2-enyl-4-(2,4,5-trimethylphenyl)-4,7-dihydro-3H-pyrrolo[3,4-d]pyrimidine-2,5-dione |
| SMILES | C=CCN1C(=O)N[C@@H](c2cc(C)c(C)cc2C)C2=C1CN(CCCC)C2=O |
| InChI | InChI=1S/C22H29N3O2/c1-6-8-10-24-13-18-19(21(24)26)20(23-22(27)25(18)9-7-2)17-12-15(4)14(3)11-16(17)5/h7,11-12,20H,2,6,8-10,13H2,1,3-5H3,(H,23,27)/t20-/m0/s1 |
| InChIKey | XMMWIFDCLHHWQK-FQEVSTJZSA-N |
| XLogP | 3.76 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|