C15H26N2O — CID 7232085
(1S,3R,4Z,6S)-N,N,3,7,7-pentamethyl-4-prop-2-enoxyiminobicyclo[4.1.0]heptan-3-amine (PubChem CID 7232085) has the molecular formula C15H26N2O and a molecular weight of 250.39 g/mol. Its IUPAC name is (1S,3R,4Z,6S)-N,N,3,7,7-pentamethyl-4-prop-2-enoxyiminobicyclo[4.1.0]heptan-3-amine.
| Compound Name | (1S,3R,4Z,6S)-N,N,3,7,7-pentamethyl-4-prop-2-enoxyiminobicyclo[4.1.0]heptan-3-amine |
|---|---|
| PubChem CID | 7232085 |
| Molecular Formula | C15H26N2O |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.20 |
| IUPAC Name | (1S,3R,4Z,6S)-N,N,3,7,7-pentamethyl-4-prop-2-enoxyiminobicyclo[4.1.0]heptan-3-amine |
| SMILES | C=CCON=C1C[C@H]2[C@H](C[C@@]1(C)N(C)C)C2(C)C |
| InChI | InChI=1S/C15H26N2O/c1-7-8-18-16-13-9-11-12(14(11,2)3)10-15(13,4)17(5)6/h7,11-12H,1,8-10H2,2-6H3/t11-,12-,15+/m0/s1 |
| InChIKey | KDOWIRPIALEFSJ-SLEUVZQESA-N |
| XLogP | 2.93 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|