C11H11F6NO — CID 723228
1-[(1S,4R)-3,3-bis(trifluoromethyl)-2-azabicyclo[2.2.1]hept-5-en-2-yl]propan-1-one (PubChem CID 723228) has the molecular formula C11H11F6NO and a molecular weight of 287.20 g/mol. Its IUPAC name is 1-[(1S,4R)-3,3-bis(trifluoromethyl)-2-azabicyclo[2.2.1]hept-5-en-2-yl]propan-1-one.
| Compound Name | 1-[(1S,4R)-3,3-bis(trifluoromethyl)-2-azabicyclo[2.2.1]hept-5-en-2-yl]propan-1-one |
|---|---|
| PubChem CID | 723228 |
| Molecular Formula | C11H11F6NO |
| Molecular Weight | 287.20 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 1-[(1S,4R)-3,3-bis(trifluoromethyl)-2-azabicyclo[2.2.1]hept-5-en-2-yl]propan-1-one |
| SMILES | CCC(=O)N1[C@@H]2C=C[C@@H](C2)C1(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H11F6NO/c1-2-8(19)18-7-4-3-6(5-7)9(18,10(12,13)14)11(15,16)17/h3-4,6-7H,2,5H2,1H3/t6-,7+/m0/s1 |
| InChIKey | ISGXDNYPTDQKAQ-NKWVEPMBSA-N |
| XLogP | 3.05 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.20 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|