C17H13NO3 — CID 723252
9-phenyl-3,6-dihydro-2H-[1,4]dioxino[2,3-g]quinolin-7-one (PubChem CID 723252) has the molecular formula C17H13NO3 and a molecular weight of 279.29 g/mol. Its IUPAC name is 9-phenyl-3,6-dihydro-2H-[1,4]dioxino[2,3-g]quinolin-7-one.
| Compound Name | 9-phenyl-3,6-dihydro-2H-[1,4]dioxino[2,3-g]quinolin-7-one |
|---|---|
| PubChem CID | 723252 |
| Molecular Formula | C17H13NO3 |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 9-phenyl-3,6-dihydro-2H-[1,4]dioxino[2,3-g]quinolin-7-one |
| SMILES | O=c1cc(-c2ccccc2)c2cc3c(cc2[nH]1)OCCO3 |
| InChI | InChI=1S/C17H13NO3/c19-17-9-12(11-4-2-1-3-5-11)13-8-15-16(10-14(13)18-17)21-7-6-20-15/h1-5,8-10H,6-7H2,(H,18,19) |
| InChIKey | NQXLDZVBZLPYHK-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |