C21H24N2O2 — CID 7233008
(5S)-7-methyl-4-pentanoyl-5-phenyl-3,5-dihydro-1H-1,4-benzodiazepin-2-one (PubChem CID 7233008) has the molecular formula C21H24N2O2 and a molecular weight of 336.44 g/mol. Its IUPAC name is (5S)-7-methyl-4-pentanoyl-5-phenyl-3,5-dihydro-1H-1,4-benzodiazepin-2-one.
| Compound Name | (5S)-7-methyl-4-pentanoyl-5-phenyl-3,5-dihydro-1H-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 7233008 |
| Molecular Formula | C21H24N2O2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | (5S)-7-methyl-4-pentanoyl-5-phenyl-3,5-dihydro-1H-1,4-benzodiazepin-2-one |
| SMILES | CCCCC(=O)N1CC(=O)Nc2ccc(C)cc2[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C21H24N2O2/c1-3-4-10-20(25)23-14-19(24)22-18-12-11-15(2)13-17(18)21(23)16-8-6-5-7-9-16/h5-9,11-13,21H,3-4,10,14H2,1-2H3,(H,22,24)/t21-/m0/s1 |
| InChIKey | GIXHJNAEIKBHDJ-NRFANRHFSA-N |
| XLogP | 4.06 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |