About spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-amine
spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-amine (PubChem CID 723336) has the molecular formula C12H15NO2
and a molecular weight of 205.26 g/mol. Its IUPAC name is spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-amine.
Molecular Properties
| Compound Name | spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-amine |
| PubChem CID | 723336 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-amine |
| SMILES | Nc1ccc2c(c1)OC1(CCCCC1)O2 |
| InChI | InChI=1S/C12H15NO2/c13-9-4-5-10-11(8-9)15-12(14-10)6-2-1-3-7-12/h4-5,8H,1-3,6-7,13H2 |
| InChIKey | ZGUHEEOHWIVGOA-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-amine?
The IUPAC name of spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-amine (CID 723336) is spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-amine.
What is the SMILES notation for spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-amine?
The canonical SMILES for spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-amine is Nc1ccc2c(c1)OC1(CCCCC1)O2.
What is the InChIKey of spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-amine?
The InChIKey is ZGUHEEOHWIVGOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO2/c13-9-4-5-10-11(8-9)15-12(14-10)6-2-1-3-7-12/h4-5,8H,1-3,6-7,13H2.
What are the key properties of spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-amine?
spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-amine has a molecular weight of 205.26 g/mol, XLogP of 2.70, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-amine is sourced from PubChem (CID 723336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).