About [(3R)-1,2,3,4-tetrahydroisoquinolin-3-yl]methanol
[(3R)-1,2,3,4-tetrahydroisoquinolin-3-yl]methanol (PubChem CID 723422) has the molecular formula C10H13NO
and a molecular weight of 163.22 g/mol. Its IUPAC name is [(3R)-1,2,3,4-tetrahydroisoquinolin-3-yl]methanol.
Molecular Properties
| Compound Name | [(3R)-1,2,3,4-tetrahydroisoquinolin-3-yl]methanol |
| PubChem CID | 723422 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | [(3R)-1,2,3,4-tetrahydroisoquinolin-3-yl]methanol |
| SMILES | OC[C@H]1Cc2ccccc2CN1 |
| InChI | InChI=1S/C10H13NO/c12-7-10-5-8-3-1-2-4-9(8)6-11-10/h1-4,10-12H,5-7H2/t10-/m1/s1 |
| InChIKey | ZSKDXMLMMQFHGW-SNVBAGLBSA-N |
| XLogP | 0.69 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(3R)-1,2,3,4-tetrahydroisoquinolin-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R)-1,2,3,4-tetrahydroisoquinolin-3-yl]methanol?
The IUPAC name of [(3R)-1,2,3,4-tetrahydroisoquinolin-3-yl]methanol (CID 723422) is [(3R)-1,2,3,4-tetrahydroisoquinolin-3-yl]methanol.
What is the SMILES notation for [(3R)-1,2,3,4-tetrahydroisoquinolin-3-yl]methanol?
The canonical SMILES for [(3R)-1,2,3,4-tetrahydroisoquinolin-3-yl]methanol is OC[C@H]1Cc2ccccc2CN1.
What is the InChIKey of [(3R)-1,2,3,4-tetrahydroisoquinolin-3-yl]methanol?
The InChIKey is ZSKDXMLMMQFHGW-SNVBAGLBSA-N. The full InChI is InChI=1S/C10H13NO/c12-7-10-5-8-3-1-2-4-9(8)6-11-10/h1-4,10-12H,5-7H2/t10-/m1/s1.
What are the key properties of [(3R)-1,2,3,4-tetrahydroisoquinolin-3-yl]methanol?
[(3R)-1,2,3,4-tetrahydroisoquinolin-3-yl]methanol has a molecular weight of 163.22 g/mol, XLogP of 0.69, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R)-1,2,3,4-tetrahydroisoquinolin-3-yl]methanol is sourced from PubChem (CID 723422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).