C16H13F6NO — CID 723441
[(1R,4S)-3,3-bis(trifluoromethyl)-2-azabicyclo[2.2.1]hept-5-en-2-yl]-(4-methylphenyl)methanone (PubChem CID 723441) has the molecular formula C16H13F6NO and a molecular weight of 349.27 g/mol. Its IUPAC name is [(1R,4S)-3,3-bis(trifluoromethyl)-2-azabicyclo[2.2.1]hept-5-en-2-yl]-(4-methylphenyl)methanone.
| Compound Name | [(1R,4S)-3,3-bis(trifluoromethyl)-2-azabicyclo[2.2.1]hept-5-en-2-yl]-(4-methylphenyl)methanone |
|---|---|
| PubChem CID | 723441 |
| Molecular Formula | C16H13F6NO |
| Molecular Weight | 349.27 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | [(1R,4S)-3,3-bis(trifluoromethyl)-2-azabicyclo[2.2.1]hept-5-en-2-yl]-(4-methylphenyl)methanone |
| SMILES | Cc1ccc(C(=O)N2[C@H]3C=C[C@H](C3)C2(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H13F6NO/c1-9-2-4-10(5-3-9)13(24)23-12-7-6-11(8-12)14(23,15(17,18)19)16(20,21)22/h2-7,11-12H,8H2,1H3/t11-,12+/m1/s1 |
| InChIKey | GUAQAAUEJQSNKZ-NEPJUHHUSA-N |
| XLogP | 4.26 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.27 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|