About 2-methyl-1,2,4-triazaspiro[4.5]decane-3-thione
2-methyl-1,2,4-triazaspiro[4.5]decane-3-thione (PubChem CID 723561) has the molecular formula C8H15N3S
and a molecular weight of 185.30 g/mol. Its IUPAC name is 2-methyl-1,2,4-triazaspiro[4.5]decane-3-thione.
Molecular Properties
| Compound Name | 2-methyl-1,2,4-triazaspiro[4.5]decane-3-thione |
| PubChem CID | 723561 |
| Molecular Formula | C8H15N3S |
| Molecular Weight | 185.30 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | 2-methyl-1,2,4-triazaspiro[4.5]decane-3-thione |
| SMILES | CN1NC2(CCCCC2)NC1=S |
| InChI | InChI=1S/C8H15N3S/c1-11-7(12)9-8(10-11)5-3-2-4-6-8/h10H,2-6H2,1H3,(H,9,12) |
| InChIKey | UCTFTVQRMRIXOB-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.30 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-1,2,4-triazaspiro[4.5]decane-3-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1,2,4-triazaspiro[4.5]decane-3-thione?
The IUPAC name of 2-methyl-1,2,4-triazaspiro[4.5]decane-3-thione (CID 723561) is 2-methyl-1,2,4-triazaspiro[4.5]decane-3-thione.
What is the SMILES notation for 2-methyl-1,2,4-triazaspiro[4.5]decane-3-thione?
The canonical SMILES for 2-methyl-1,2,4-triazaspiro[4.5]decane-3-thione is CN1NC2(CCCCC2)NC1=S.
What is the InChIKey of 2-methyl-1,2,4-triazaspiro[4.5]decane-3-thione?
The InChIKey is UCTFTVQRMRIXOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3S/c1-11-7(12)9-8(10-11)5-3-2-4-6-8/h10H,2-6H2,1H3,(H,9,12).
What are the key properties of 2-methyl-1,2,4-triazaspiro[4.5]decane-3-thione?
2-methyl-1,2,4-triazaspiro[4.5]decane-3-thione has a molecular weight of 185.30 g/mol, XLogP of 0.97, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1,2,4-triazaspiro[4.5]decane-3-thione is sourced from PubChem (CID 723561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).