C18H15ClN2O4 — CID 7235642
[(2S)-1-(4-cyanoanilino)-1-oxopropan-2-yl] 5-chloro-2-methoxybenzoate (PubChem CID 7235642) has the molecular formula C18H15ClN2O4 and a molecular weight of 358.78 g/mol. Its IUPAC name is [(2S)-1-(4-cyanoanilino)-1-oxopropan-2-yl] 5-chloro-2-methoxybenzoate.
| Compound Name | [(2S)-1-(4-cyanoanilino)-1-oxopropan-2-yl] 5-chloro-2-methoxybenzoate |
|---|---|
| PubChem CID | 7235642 |
| Molecular Formula | C18H15ClN2O4 |
| Molecular Weight | 358.78 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | [(2S)-1-(4-cyanoanilino)-1-oxopropan-2-yl] 5-chloro-2-methoxybenzoate |
| SMILES | COc1ccc(Cl)cc1C(=O)O[C@@H](C)C(=O)Nc1ccc(C#N)cc1 |
| InChI | InChI=1S/C18H15ClN2O4/c1-11(17(22)21-14-6-3-12(10-20)4-7-14)25-18(23)15-9-13(19)5-8-16(15)24-2/h3-9,11H,1-2H3,(H,21,22)/t11-/m0/s1 |
| InChIKey | DDCUBLUMNVARFY-NSHDSACASA-N |
| XLogP | 3.40 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.78 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |