About 1-bromo-2-methylbenzene
1-bromo-2-methylbenzene (PubChem CID 7236) has the molecular formula C7H7Br
and a molecular weight of 171.04 g/mol. Its IUPAC name is 1-bromo-2-methylbenzene.
Molecular Properties
| Compound Name | 1-bromo-2-methylbenzene |
| PubChem CID | 7236 |
| Molecular Formula | C7H7Br |
| Molecular Weight | 171.04 g/mol |
| Exact Mass | 169.97 |
| IUPAC Name | 1-bromo-2-methylbenzene |
| SMILES | Cc1ccccc1Br |
| InChI | InChI=1S/C7H7Br/c1-6-4-2-3-5-7(6)8/h2-5H,1H3 |
| InChIKey | QSSXJPIWXQTSIX-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.04 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-bromo-2-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-2-methylbenzene?
The IUPAC name of 1-bromo-2-methylbenzene (CID 7236) is 1-bromo-2-methylbenzene.
What is the SMILES notation for 1-bromo-2-methylbenzene?
The canonical SMILES for 1-bromo-2-methylbenzene is Cc1ccccc1Br.
What is the InChIKey of 1-bromo-2-methylbenzene?
The InChIKey is QSSXJPIWXQTSIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7Br/c1-6-4-2-3-5-7(6)8/h2-5H,1H3.
What are the key properties of 1-bromo-2-methylbenzene?
1-bromo-2-methylbenzene has a molecular weight of 171.04 g/mol, XLogP of 2.76, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-2-methylbenzene is sourced from PubChem (CID 7236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).