C23H22N4 — CID 7236044
N-[(Z)-[1-phenyl-2-[(3S)-2-phenyl-3,4-dihydropyrazol-3-yl]ethylidene]amino]aniline (PubChem CID 7236044) has the molecular formula C23H22N4 and a molecular weight of 354.46 g/mol. Its IUPAC name is N-[(Z)-[1-phenyl-2-[(3S)-2-phenyl-3,4-dihydropyrazol-3-yl]ethylidene]amino]aniline.
| Compound Name | N-[(Z)-[1-phenyl-2-[(3S)-2-phenyl-3,4-dihydropyrazol-3-yl]ethylidene]amino]aniline |
|---|---|
| PubChem CID | 7236044 |
| Molecular Formula | C23H22N4 |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | N-[(Z)-[1-phenyl-2-[(3S)-2-phenyl-3,4-dihydropyrazol-3-yl]ethylidene]amino]aniline |
| SMILES | C1=NN(c2ccccc2)[C@H](C/C(=N/Nc2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C23H22N4/c1-4-10-19(11-5-1)23(26-25-20-12-6-2-7-13-20)18-22-16-17-24-27(22)21-14-8-3-9-15-21/h1-15,17,22,25H,16,18H2/b26-23-/t22-/m0/s1 |
| InChIKey | FHOOQCMDWIVKCV-NFLAHJKKSA-N |
| XLogP | 5.16 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|