C21H24N2O3 — CID 7236685
(3R)-N-(2-methylphenyl)-5-oxo-1-(4-propoxyphenyl)pyrrolidine-3-carboxamide (PubChem CID 7236685) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is (3R)-N-(2-methylphenyl)-5-oxo-1-(4-propoxyphenyl)pyrrolidine-3-carboxamide.
| Compound Name | (3R)-N-(2-methylphenyl)-5-oxo-1-(4-propoxyphenyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 7236685 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | (3R)-N-(2-methylphenyl)-5-oxo-1-(4-propoxyphenyl)pyrrolidine-3-carboxamide |
| SMILES | CCCOc1ccc(N2C[C@H](C(=O)Nc3ccccc3C)CC2=O)cc1 |
| InChI | InChI=1S/C21H24N2O3/c1-3-12-26-18-10-8-17(9-11-18)23-14-16(13-20(23)24)21(25)22-19-7-5-4-6-15(19)2/h4-11,16H,3,12-14H2,1-2H3,(H,22,25)/t16-/m1/s1 |
| InChIKey | YVWRWECRIAGBAS-MRXNPFEDSA-N |
| XLogP | 3.78 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |