About (4R)-3-methyl-4,6-diphenyl-4,5-dihydro-2H-indazole
(4R)-3-methyl-4,6-diphenyl-4,5-dihydro-2H-indazole (PubChem CID 7237542) has the molecular formula C20H18N2
and a molecular weight of 286.38 g/mol. Its IUPAC name is (4R)-3-methyl-4,6-diphenyl-4,5-dihydro-2H-indazole.
Molecular Properties
| Compound Name | (4R)-3-methyl-4,6-diphenyl-4,5-dihydro-2H-indazole |
| PubChem CID | 7237542 |
| Molecular Formula | C20H18N2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | (4R)-3-methyl-4,6-diphenyl-4,5-dihydro-2H-indazole |
| SMILES | Cc1[nH]nc2c1[C@@H](c1ccccc1)CC(c1ccccc1)=C2 |
| InChI | InChI=1S/C20H18N2/c1-14-20-18(16-10-6-3-7-11-16)12-17(13-19(20)22-21-14)15-8-4-2-5-9-15/h2-11,13,18H,12H2,1H3,(H,21,22)/t18-/m1/s1 |
| InChIKey | ZUSIICUPKNHFQY-GOSISDBHSA-N |
| XLogP | 4.79 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (4R)-3-methyl-4,6-diphenyl-4,5-dihydro-2H-indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-3-methyl-4,6-diphenyl-4,5-dihydro-2H-indazole?
The IUPAC name of (4R)-3-methyl-4,6-diphenyl-4,5-dihydro-2H-indazole (CID 7237542) is (4R)-3-methyl-4,6-diphenyl-4,5-dihydro-2H-indazole.
What is the SMILES notation for (4R)-3-methyl-4,6-diphenyl-4,5-dihydro-2H-indazole?
The canonical SMILES for (4R)-3-methyl-4,6-diphenyl-4,5-dihydro-2H-indazole is Cc1[nH]nc2c1[C@@H](c1ccccc1)CC(c1ccccc1)=C2.
What is the InChIKey of (4R)-3-methyl-4,6-diphenyl-4,5-dihydro-2H-indazole?
The InChIKey is ZUSIICUPKNHFQY-GOSISDBHSA-N. The full InChI is InChI=1S/C20H18N2/c1-14-20-18(16-10-6-3-7-11-16)12-17(13-19(20)22-21-14)15-8-4-2-5-9-15/h2-11,13,18H,12H2,1H3,(H,21,22)/t18-/m1/s1.
What are the key properties of (4R)-3-methyl-4,6-diphenyl-4,5-dihydro-2H-indazole?
(4R)-3-methyl-4,6-diphenyl-4,5-dihydro-2H-indazole has a molecular weight of 286.38 g/mol, XLogP of 4.79, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-3-methyl-4,6-diphenyl-4,5-dihydro-2H-indazole is sourced from PubChem (CID 7237542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).