C20H18FN2O4- — CID 7237806
(2R)-2-[[(Z)-2-acetamido-3-(4-fluorophenyl)prop-2-enoyl]amino]-3-phenylpropanoate (PubChem CID 7237806) has the molecular formula C20H18FN2O4- and a molecular weight of 369.37 g/mol. Its IUPAC name is (2R)-2-[[(Z)-2-acetamido-3-(4-fluorophenyl)prop-2-enoyl]amino]-3-phenylpropanoate.
| Compound Name | (2R)-2-[[(Z)-2-acetamido-3-(4-fluorophenyl)prop-2-enoyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 7237806 |
| Molecular Formula | C20H18FN2O4- |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | (2R)-2-[[(Z)-2-acetamido-3-(4-fluorophenyl)prop-2-enoyl]amino]-3-phenylpropanoate |
| SMILES | CC(=O)N/C(=C\c1ccc(F)cc1)C(=O)N[C@H](Cc1ccccc1)C(=O)[O-] |
| InChI | InChI=1S/C20H19FN2O4/c1-13(24)22-17(11-15-7-9-16(21)10-8-15)19(25)23-18(20(26)27)12-14-5-3-2-4-6-14/h2-11,18H,12H2,1H3,(H,22,24)(H,23,25)(H,26,27)/p-1/b17-11-/t18-/m1/s1 |
| InChIKey | LSUOFGACKWWEQF-UWKDKTGGSA-M |
| XLogP | 0.78 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|